C6H6O2 — CID 11389380
1,2,4,5-tetradeuterio-3,6-dideuteriooxybenzene (PubChem CID 11389380) has the molecular formula C6H6O2 and a molecular weight of 116.15 g/mol. Its IUPAC name is 1,2,4,5-tetradeuterio-3,6-dideuteriooxybenzene.
| Compound Name | 1,2,4,5-tetradeuterio-3,6-dideuteriooxybenzene |
|---|---|
| PubChem CID | 11389380 |
| Molecular Formula | C6H6O2 |
| Molecular Weight | 116.15 g/mol |
| Exact Mass | 116.07 |
| IUPAC Name | 1,2,4,5-tetradeuterio-3,6-dideuteriooxybenzene |
| SMILES | [2H]Oc1c([2H])c([2H])c(O[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C6H6O2/c7-5-1-2-6(8)4-3-5/h1-4,7-8H/i1D,2D,3D,4D/hD2 |
| InChIKey | QIGBRXMKCJKVMJ-UDDMDDBKSA-N |
| XLogP | 1.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.15 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|