About 5-hydroxyimidazo[4,5-c]pyridine
5-hydroxyimidazo[4,5-c]pyridine (PubChem CID 11389410) has the molecular formula C6H5N3O
and a molecular weight of 135.13 g/mol. Its IUPAC name is 5-hydroxyimidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 5-hydroxyimidazo[4,5-c]pyridine |
| PubChem CID | 11389410 |
| Molecular Formula | C6H5N3O |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | 5-hydroxyimidazo[4,5-c]pyridine |
| SMILES | On1ccc2ncnc-2c1 |
| InChI | InChI=1S/C6H5N3O/c10-9-2-1-5-6(3-9)8-4-7-5/h1-4,10H |
| InChIKey | WNDRTAHLSKIFJM-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxyimidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxyimidazo[4,5-c]pyridine?
The IUPAC name of 5-hydroxyimidazo[4,5-c]pyridine (CID 11389410) is 5-hydroxyimidazo[4,5-c]pyridine.
What is the SMILES notation for 5-hydroxyimidazo[4,5-c]pyridine?
The canonical SMILES for 5-hydroxyimidazo[4,5-c]pyridine is On1ccc2ncnc-2c1.
What is the InChIKey of 5-hydroxyimidazo[4,5-c]pyridine?
The InChIKey is WNDRTAHLSKIFJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O/c10-9-2-1-5-6(3-9)8-4-7-5/h1-4,10H.
What are the key properties of 5-hydroxyimidazo[4,5-c]pyridine?
5-hydroxyimidazo[4,5-c]pyridine has a molecular weight of 135.13 g/mol, XLogP of 0.62, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxyimidazo[4,5-c]pyridine is sourced from PubChem (CID 11389410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).