About 2-hexyl-3-methoxy-2,5-dihydrofuran
2-hexyl-3-methoxy-2,5-dihydrofuran (PubChem CID 11389794) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-hexyl-3-methoxy-2,5-dihydrofuran.
Molecular Properties
| Compound Name | 2-hexyl-3-methoxy-2,5-dihydrofuran |
| PubChem CID | 11389794 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 2-hexyl-3-methoxy-2,5-dihydrofuran |
| SMILES | CCCCCCC1OCC=C1OC |
| InChI | InChI=1S/C11H20O2/c1-3-4-5-6-7-11-10(12-2)8-9-13-11/h8,11H,3-7,9H2,1-2H3 |
| InChIKey | XLQBWRHSEGSMFA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hexyl-3-methoxy-2,5-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexyl-3-methoxy-2,5-dihydrofuran?
The IUPAC name of 2-hexyl-3-methoxy-2,5-dihydrofuran (CID 11389794) is 2-hexyl-3-methoxy-2,5-dihydrofuran.
What is the SMILES notation for 2-hexyl-3-methoxy-2,5-dihydrofuran?
The canonical SMILES for 2-hexyl-3-methoxy-2,5-dihydrofuran is CCCCCCC1OCC=C1OC.
What is the InChIKey of 2-hexyl-3-methoxy-2,5-dihydrofuran?
The InChIKey is XLQBWRHSEGSMFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-3-4-5-6-7-11-10(12-2)8-9-13-11/h8,11H,3-7,9H2,1-2H3.
What are the key properties of 2-hexyl-3-methoxy-2,5-dihydrofuran?
2-hexyl-3-methoxy-2,5-dihydrofuran has a molecular weight of 184.28 g/mol, XLogP of 2.89, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexyl-3-methoxy-2,5-dihydrofuran is sourced from PubChem (CID 11389794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).