C11H10N2O — CID 11389823
9-ethynyl-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one (PubChem CID 11389823) has the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. Its IUPAC name is 9-ethynyl-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one.
| Compound Name | 9-ethynyl-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one |
|---|---|
| PubChem CID | 11389823 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 9-ethynyl-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one |
| SMILES | C#Cc1cccc2c1NCCNC2=O |
| InChI | InChI=1S/C11H10N2O/c1-2-8-4-3-5-9-10(8)12-6-7-13-11(9)14/h1,3-5,12H,6-7H2,(H,13,14) |
| InChIKey | UXEDRFAVJTXWBY-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|