naphthalene-2,6-disulfonic acid

C10H8O6S2 — CID 11390

IUPACnaphthalene-2,6-disulfonic acid
SMILESO=S(=O)(O)c1ccc2cc(S(=O)(=O)O)ccc2c1
InChIInChI=1S/C10H8O6S2/c11-17(12,13)9-3-1-7-5-10(18(14,15)16)4-2-8(7)6-9/h1-6H,(H,11,12,13)(H,14,15,16)
InChIKeyFITZJYAVATZPMJ-UHFFFAOYSA-N
MW288.30 g/mol
LogP1.33
Rot. Bonds2

About naphthalene-2,6-disulfonic acid

naphthalene-2,6-disulfonic acid (PubChem CID 11390) has the molecular formula C10H8O6S2 and a molecular weight of 288.30 g/mol. Its IUPAC name is naphthalene-2,6-disulfonic acid.

Molecular Properties

Compound Namenaphthalene-2,6-disulfonic acid
PubChem CID11390
Molecular FormulaC10H8O6S2
Molecular Weight288.30 g/mol
Exact Mass287.98
IUPAC Namenaphthalene-2,6-disulfonic acid
SMILESO=S(=O)(O)c1ccc2cc(S(=O)(=O)O)ccc2c1
InChIInChI=1S/C10H8O6S2/c11-17(12,13)9-3-1-7-5-10(18(14,15)16)4-2-8(7)6-9/h1-6H,(H,11,12,13)(H,14,15,16)
InChIKeyFITZJYAVATZPMJ-UHFFFAOYSA-N
XLogP1.33
TPSA108.74 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.30
LogP ≤ 51.33
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze naphthalene-2,6-disulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of naphthalene-2,6-disulfonic acid?
The IUPAC name of naphthalene-2,6-disulfonic acid (CID 11390) is naphthalene-2,6-disulfonic acid.
What is the SMILES notation for naphthalene-2,6-disulfonic acid?
The canonical SMILES for naphthalene-2,6-disulfonic acid is O=S(=O)(O)c1ccc2cc(S(=O)(=O)O)ccc2c1.
What is the InChIKey of naphthalene-2,6-disulfonic acid?
The InChIKey is FITZJYAVATZPMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O6S2/c11-17(12,13)9-3-1-7-5-10(18(14,15)16)4-2-8(7)6-9/h1-6H,(H,11,12,13)(H,14,15,16).
What are the key properties of naphthalene-2,6-disulfonic acid?
naphthalene-2,6-disulfonic acid has a molecular weight of 288.30 g/mol, XLogP of 1.33, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-2,6-disulfonic acid is sourced from PubChem (CID 11390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).