C12H15NO2 — CID 11390109
(3R,4R)-2-benzyl-3,4-dimethyl-1,2-oxazolidin-5-one (PubChem CID 11390109) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is (3R,4R)-2-benzyl-3,4-dimethyl-1,2-oxazolidin-5-one.
| Compound Name | (3R,4R)-2-benzyl-3,4-dimethyl-1,2-oxazolidin-5-one |
|---|---|
| PubChem CID | 11390109 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (3R,4R)-2-benzyl-3,4-dimethyl-1,2-oxazolidin-5-one |
| SMILES | C[C@@H]1[C@@H](C)C(=O)ON1Cc1ccccc1 |
| InChI | InChI=1S/C12H15NO2/c1-9-10(2)13(15-12(9)14)8-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | PBGOPDVEJUQQKF-NXEZZACHSA-N |
| XLogP | 1.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |