About 3-(cyclohexen-1-yl)buta-1,2-dienylbenzene
3-(cyclohexen-1-yl)buta-1,2-dienylbenzene (PubChem CID 11390193) has the molecular formula C16H18
and a molecular weight of 210.32 g/mol. Its IUPAC name is 3-(cyclohexen-1-yl)buta-1,2-dienylbenzene.
Molecular Properties
| Compound Name | 3-(cyclohexen-1-yl)buta-1,2-dienylbenzene |
| PubChem CID | 11390193 |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 3-(cyclohexen-1-yl)buta-1,2-dienylbenzene |
| SMILES | CC(=C=Cc1ccccc1)C1=CCCCC1 |
| InChI | InChI=1S/C16H18/c1-14(16-10-6-3-7-11-16)12-13-15-8-4-2-5-9-15/h2,4-5,8-10,13H,3,6-7,11H2,1H3 |
| InChIKey | DRXGHTPZQPBQCP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-(cyclohexen-1-yl)buta-1,2-dienylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclohexen-1-yl)buta-1,2-dienylbenzene?
The IUPAC name of 3-(cyclohexen-1-yl)buta-1,2-dienylbenzene (CID 11390193) is 3-(cyclohexen-1-yl)buta-1,2-dienylbenzene.
What is the SMILES notation for 3-(cyclohexen-1-yl)buta-1,2-dienylbenzene?
The canonical SMILES for 3-(cyclohexen-1-yl)buta-1,2-dienylbenzene is CC(=C=Cc1ccccc1)C1=CCCCC1.
What is the InChIKey of 3-(cyclohexen-1-yl)buta-1,2-dienylbenzene?
The InChIKey is DRXGHTPZQPBQCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18/c1-14(16-10-6-3-7-11-16)12-13-15-8-4-2-5-9-15/h2,4-5,8-10,13H,3,6-7,11H2,1H3.
What are the key properties of 3-(cyclohexen-1-yl)buta-1,2-dienylbenzene?
3-(cyclohexen-1-yl)buta-1,2-dienylbenzene has a molecular weight of 210.32 g/mol, XLogP of 4.75, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclohexen-1-yl)buta-1,2-dienylbenzene is sourced from PubChem (CID 11390193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).