About 4-(diethoxymethyl)-1,2-dimethylcyclohexene
4-(diethoxymethyl)-1,2-dimethylcyclohexene (PubChem CID 11390223) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is 4-(diethoxymethyl)-1,2-dimethylcyclohexene.
Molecular Properties
| Compound Name | 4-(diethoxymethyl)-1,2-dimethylcyclohexene |
| PubChem CID | 11390223 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 4-(diethoxymethyl)-1,2-dimethylcyclohexene |
| SMILES | CCOC(OCC)C1CCC(C)=C(C)C1 |
| InChI | InChI=1S/C13H24O2/c1-5-14-13(15-6-2)12-8-7-10(3)11(4)9-12/h12-13H,5-9H2,1-4H3 |
| InChIKey | BPHAFDNKESYJFA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(diethoxymethyl)-1,2-dimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(diethoxymethyl)-1,2-dimethylcyclohexene?
The IUPAC name of 4-(diethoxymethyl)-1,2-dimethylcyclohexene (CID 11390223) is 4-(diethoxymethyl)-1,2-dimethylcyclohexene.
What is the SMILES notation for 4-(diethoxymethyl)-1,2-dimethylcyclohexene?
The canonical SMILES for 4-(diethoxymethyl)-1,2-dimethylcyclohexene is CCOC(OCC)C1CCC(C)=C(C)C1.
What is the InChIKey of 4-(diethoxymethyl)-1,2-dimethylcyclohexene?
The InChIKey is BPHAFDNKESYJFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2/c1-5-14-13(15-6-2)12-8-7-10(3)11(4)9-12/h12-13H,5-9H2,1-4H3.
What are the key properties of 4-(diethoxymethyl)-1,2-dimethylcyclohexene?
4-(diethoxymethyl)-1,2-dimethylcyclohexene has a molecular weight of 212.33 g/mol, XLogP of 3.52, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(diethoxymethyl)-1,2-dimethylcyclohexene is sourced from PubChem (CID 11390223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).