3-trimethoxysilylpropylazanium chloride

C6H18ClNO3Si — CID 11390286

IUPAC3-trimethoxysilylpropylazanium chloride
SMILESCO[Si](CCC[NH3+])(OC)OC.[Cl-]
InChIInChI=1S/C6H17NO3Si.ClH/c1-8-11(9-2,10-3)6-4-5-7;/h4-7H2,1-3H3;1H
InChIKeyGZWRMQNNGRSSNL-UHFFFAOYSA-N
MW215.75 g/mol
LogP-3.50
Rot. Bonds6

About 3-trimethoxysilylpropylazanium chloride

3-trimethoxysilylpropylazanium chloride (PubChem CID 11390286) has the molecular formula C6H18ClNO3Si and a molecular weight of 215.75 g/mol. Its IUPAC name is 3-trimethoxysilylpropylazanium chloride.

Molecular Properties

Compound Name3-trimethoxysilylpropylazanium chloride
PubChem CID11390286
Molecular FormulaC6H18ClNO3Si
Molecular Weight215.75 g/mol
Exact Mass215.07
IUPAC Name3-trimethoxysilylpropylazanium chloride
SMILESCO[Si](CCC[NH3+])(OC)OC.[Cl-]
InChIInChI=1S/C6H17NO3Si.ClH/c1-8-11(9-2,10-3)6-4-5-7;/h4-7H2,1-3H3;1H
InChIKeyGZWRMQNNGRSSNL-UHFFFAOYSA-N
XLogP-3.50
TPSA55.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.75
LogP ≤ 5-3.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze 3-trimethoxysilylpropylazanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-trimethoxysilylpropylazanium chloride?
The IUPAC name of 3-trimethoxysilylpropylazanium chloride (CID 11390286) is 3-trimethoxysilylpropylazanium chloride.
What is the SMILES notation for 3-trimethoxysilylpropylazanium chloride?
The canonical SMILES for 3-trimethoxysilylpropylazanium chloride is CO[Si](CCC[NH3+])(OC)OC.[Cl-].
What is the InChIKey of 3-trimethoxysilylpropylazanium chloride?
The InChIKey is GZWRMQNNGRSSNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H17NO3Si.ClH/c1-8-11(9-2,10-3)6-4-5-7;/h4-7H2,1-3H3;1H.
What are the key properties of 3-trimethoxysilylpropylazanium chloride?
3-trimethoxysilylpropylazanium chloride has a molecular weight of 215.75 g/mol, XLogP of -3.50, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-trimethoxysilylpropylazanium chloride is sourced from PubChem (CID 11390286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).