C15H22O — CID 11390349
(1S,4S,8Z,13S)-5,5,9-trimethyl-3-oxatricyclo[5.5.1.04,13]trideca-6,8-diene (PubChem CID 11390349) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (1S,4S,8Z,13S)-5,5,9-trimethyl-3-oxatricyclo[5.5.1.04,13]trideca-6,8-diene.
| Compound Name | (1S,4S,8Z,13S)-5,5,9-trimethyl-3-oxatricyclo[5.5.1.04,13]trideca-6,8-diene |
|---|---|
| PubChem CID | 11390349 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (1S,4S,8Z,13S)-5,5,9-trimethyl-3-oxatricyclo[5.5.1.04,13]trideca-6,8-diene |
| SMILES | C/C1=C/C2=CC(C)(C)[C@H]3OC[C@@H](CCC1)[C@@H]23 |
| InChI | InChI=1S/C15H22O/c1-10-5-4-6-11-9-16-14-13(11)12(7-10)8-15(14,2)3/h7-8,11,13-14H,4-6,9H2,1-3H3/b10-7-/t11-,13+,14+/m1/s1 |
| InChIKey | CLZMNFGQBCUQSD-GGUVDMOTSA-N |
| XLogP | 3.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |