About 8-methoxytetrazolo[1,5-a]quinoline-4-carbaldehyde
8-methoxytetrazolo[1,5-a]quinoline-4-carbaldehyde (PubChem CID 11390537) has the molecular formula C11H8N4O2
and a molecular weight of 228.21 g/mol. Its IUPAC name is 8-methoxytetrazolo[1,5-a]quinoline-4-carbaldehyde.
Molecular Properties
| Compound Name | 8-methoxytetrazolo[1,5-a]quinoline-4-carbaldehyde |
| PubChem CID | 11390537 |
| Molecular Formula | C11H8N4O2 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 8-methoxytetrazolo[1,5-a]quinoline-4-carbaldehyde |
| SMILES | COc1ccc2cc(C=O)c3nnnn3c2c1 |
| InChI | InChI=1S/C11H8N4O2/c1-17-9-3-2-7-4-8(6-16)11-12-13-14-15(11)10(7)5-9/h2-6H,1H3 |
| InChIKey | BGBWNDUMVSMUIY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 8-methoxytetrazolo[1,5-a]quinoline-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxytetrazolo[1,5-a]quinoline-4-carbaldehyde?
The IUPAC name of 8-methoxytetrazolo[1,5-a]quinoline-4-carbaldehyde (CID 11390537) is 8-methoxytetrazolo[1,5-a]quinoline-4-carbaldehyde.
What is the SMILES notation for 8-methoxytetrazolo[1,5-a]quinoline-4-carbaldehyde?
The canonical SMILES for 8-methoxytetrazolo[1,5-a]quinoline-4-carbaldehyde is COc1ccc2cc(C=O)c3nnnn3c2c1.
What is the InChIKey of 8-methoxytetrazolo[1,5-a]quinoline-4-carbaldehyde?
The InChIKey is BGBWNDUMVSMUIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4O2/c1-17-9-3-2-7-4-8(6-16)11-12-13-14-15(11)10(7)5-9/h2-6H,1H3.
What are the key properties of 8-methoxytetrazolo[1,5-a]quinoline-4-carbaldehyde?
8-methoxytetrazolo[1,5-a]quinoline-4-carbaldehyde has a molecular weight of 228.21 g/mol, XLogP of 1.10, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxytetrazolo[1,5-a]quinoline-4-carbaldehyde is sourced from PubChem (CID 11390537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).