C15H18O2 — CID 11390589
(2'aS,8'bR)-8'-methylspiro[1,3-dioxolane-2,3'-2,2a,4,8b-tetrahydro-1H-cyclobuta[a]naphthalene] (PubChem CID 11390589) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (2'aS,8'bR)-8'-methylspiro[1,3-dioxolane-2,3'-2,2a,4,8b-tetrahydro-1H-cyclobuta[a]naphthalene].
| Compound Name | (2'aS,8'bR)-8'-methylspiro[1,3-dioxolane-2,3'-2,2a,4,8b-tetrahydro-1H-cyclobuta[a]naphthalene] |
|---|---|
| PubChem CID | 11390589 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (2'aS,8'bR)-8'-methylspiro[1,3-dioxolane-2,3'-2,2a,4,8b-tetrahydro-1H-cyclobuta[a]naphthalene] |
| SMILES | Cc1cccc2c1[C@@H]1CC[C@@H]1C1(C2)OCCO1 |
| InChI | InChI=1S/C15H18O2/c1-10-3-2-4-11-9-15(16-7-8-17-15)13-6-5-12(13)14(10)11/h2-4,12-13H,5-9H2,1H3/t12-,13+/m1/s1 |
| InChIKey | PNZKZJQISYKTNQ-OLZOCXBDSA-N |
| XLogP | 2.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |