About propan-2-yl (4R)-2,2-diethyl-1,3-thiazolidine-4-carboxylate
propan-2-yl (4R)-2,2-diethyl-1,3-thiazolidine-4-carboxylate (PubChem CID 11390619) has the molecular formula C11H21NO2S
and a molecular weight of 231.36 g/mol. Its IUPAC name is propan-2-yl (4R)-2,2-diethyl-1,3-thiazolidine-4-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl (4R)-2,2-diethyl-1,3-thiazolidine-4-carboxylate |
| PubChem CID | 11390619 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | propan-2-yl (4R)-2,2-diethyl-1,3-thiazolidine-4-carboxylate |
| SMILES | CCC1(CC)N[C@H](C(=O)OC(C)C)CS1 |
| InChI | InChI=1S/C11H21NO2S/c1-5-11(6-2)12-9(7-15-11)10(13)14-8(3)4/h8-9,12H,5-7H2,1-4H3/t9-/m0/s1 |
| InChIKey | BZMPAIHWEFULON-VIFPVBQESA-N |
| XLogP | 2.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propan-2-yl (4R)-2,2-diethyl-1,3-thiazolidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (4R)-2,2-diethyl-1,3-thiazolidine-4-carboxylate?
The IUPAC name of propan-2-yl (4R)-2,2-diethyl-1,3-thiazolidine-4-carboxylate (CID 11390619) is propan-2-yl (4R)-2,2-diethyl-1,3-thiazolidine-4-carboxylate.
What is the SMILES notation for propan-2-yl (4R)-2,2-diethyl-1,3-thiazolidine-4-carboxylate?
The canonical SMILES for propan-2-yl (4R)-2,2-diethyl-1,3-thiazolidine-4-carboxylate is CCC1(CC)N[C@H](C(=O)OC(C)C)CS1.
What is the InChIKey of propan-2-yl (4R)-2,2-diethyl-1,3-thiazolidine-4-carboxylate?
The InChIKey is BZMPAIHWEFULON-VIFPVBQESA-N. The full InChI is InChI=1S/C11H21NO2S/c1-5-11(6-2)12-9(7-15-11)10(13)14-8(3)4/h8-9,12H,5-7H2,1-4H3/t9-/m0/s1.
What are the key properties of propan-2-yl (4R)-2,2-diethyl-1,3-thiazolidine-4-carboxylate?
propan-2-yl (4R)-2,2-diethyl-1,3-thiazolidine-4-carboxylate has a molecular weight of 231.36 g/mol, XLogP of 2.16, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (4R)-2,2-diethyl-1,3-thiazolidine-4-carboxylate is sourced from PubChem (CID 11390619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).