C13H20O2Si — CID 11390731
ethyl (2E,4E)-2-methyl-7-trimethylsilylhepta-2,4-dien-6-ynoate (PubChem CID 11390731) has the molecular formula C13H20O2Si and a molecular weight of 236.39 g/mol. Its IUPAC name is ethyl (2E,4E)-2-methyl-7-trimethylsilylhepta-2,4-dien-6-ynoate.
| Compound Name | ethyl (2E,4E)-2-methyl-7-trimethylsilylhepta-2,4-dien-6-ynoate |
|---|---|
| PubChem CID | 11390731 |
| Molecular Formula | C13H20O2Si |
| Molecular Weight | 236.39 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | ethyl (2E,4E)-2-methyl-7-trimethylsilylhepta-2,4-dien-6-ynoate |
| SMILES | CCOC(=O)/C(C)=C/C=C/C#C[Si](C)(C)C |
| InChI | InChI=1S/C13H20O2Si/c1-6-15-13(14)12(2)10-8-7-9-11-16(3,4)5/h7-8,10H,6H2,1-5H3/b8-7+,12-10+ |
| InChIKey | WBRDVEINWISYRU-DCXZXJRMSA-N |
| XLogP | 2.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|