About 3,8-dimethoxy-1,10-phenanthroline
3,8-dimethoxy-1,10-phenanthroline (PubChem CID 11390810) has the molecular formula C14H12N2O2
and a molecular weight of 240.26 g/mol. Its IUPAC name is 3,8-dimethoxy-1,10-phenanthroline.
Molecular Properties
| Compound Name | 3,8-dimethoxy-1,10-phenanthroline |
| PubChem CID | 11390810 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 3,8-dimethoxy-1,10-phenanthroline |
| SMILES | COc1cnc2c(ccc3cc(OC)cnc32)c1 |
| InChI | InChI=1S/C14H12N2O2/c1-17-11-5-9-3-4-10-6-12(18-2)8-16-14(10)13(9)15-7-11/h3-8H,1-2H3 |
| InChIKey | DHYIXGVYUMTGRG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3,8-dimethoxy-1,10-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dimethoxy-1,10-phenanthroline?
The IUPAC name of 3,8-dimethoxy-1,10-phenanthroline (CID 11390810) is 3,8-dimethoxy-1,10-phenanthroline.
What is the SMILES notation for 3,8-dimethoxy-1,10-phenanthroline?
The canonical SMILES for 3,8-dimethoxy-1,10-phenanthroline is COc1cnc2c(ccc3cc(OC)cnc32)c1.
What is the InChIKey of 3,8-dimethoxy-1,10-phenanthroline?
The InChIKey is DHYIXGVYUMTGRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O2/c1-17-11-5-9-3-4-10-6-12(18-2)8-16-14(10)13(9)15-7-11/h3-8H,1-2H3.
What are the key properties of 3,8-dimethoxy-1,10-phenanthroline?
3,8-dimethoxy-1,10-phenanthroline has a molecular weight of 240.26 g/mol, XLogP of 2.80, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dimethoxy-1,10-phenanthroline is sourced from PubChem (CID 11390810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).