About 4-methoxy-9,10-dihydrophenanthrene-2,7-diol
4-methoxy-9,10-dihydrophenanthrene-2,7-diol (PubChem CID 11390848) has the molecular formula C15H14O3
and a molecular weight of 242.27 g/mol. Its IUPAC name is 4-methoxy-9,10-dihydrophenanthrene-2,7-diol.
Molecular Properties
| Compound Name | 4-methoxy-9,10-dihydrophenanthrene-2,7-diol |
| PubChem CID | 11390848 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 4-methoxy-9,10-dihydrophenanthrene-2,7-diol |
| SMILES | COc1cc(O)cc2c1-c1ccc(O)cc1CC2 |
| InChI | InChI=1S/C15H14O3/c1-18-14-8-12(17)7-10-3-2-9-6-11(16)4-5-13(9)15(10)14/h4-8,16-17H,2-3H2,1H3 |
| InChIKey | OPPGAHUCKDKQJR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxy-9,10-dihydrophenanthrene-2,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-9,10-dihydrophenanthrene-2,7-diol?
The IUPAC name of 4-methoxy-9,10-dihydrophenanthrene-2,7-diol (CID 11390848) is 4-methoxy-9,10-dihydrophenanthrene-2,7-diol.
What is the SMILES notation for 4-methoxy-9,10-dihydrophenanthrene-2,7-diol?
The canonical SMILES for 4-methoxy-9,10-dihydrophenanthrene-2,7-diol is COc1cc(O)cc2c1-c1ccc(O)cc1CC2.
What is the InChIKey of 4-methoxy-9,10-dihydrophenanthrene-2,7-diol?
The InChIKey is OPPGAHUCKDKQJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O3/c1-18-14-8-12(17)7-10-3-2-9-6-11(16)4-5-13(9)15(10)14/h4-8,16-17H,2-3H2,1H3.
What are the key properties of 4-methoxy-9,10-dihydrophenanthrene-2,7-diol?
4-methoxy-9,10-dihydrophenanthrene-2,7-diol has a molecular weight of 242.27 g/mol, XLogP of 2.87, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-9,10-dihydrophenanthrene-2,7-diol is sourced from PubChem (CID 11390848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).