C14H22O4 — CID 11391161
(3R,3aS,4R,7aR)-3-hydroxy-3a,4-dimethyl-4-(3-oxobutyl)-3,6,7,7a-tetrahydro-1H-2-benzofuran-5-one (PubChem CID 11391161) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is (3R,3aS,4R,7aR)-3-hydroxy-3a,4-dimethyl-4-(3-oxobutyl)-3,6,7,7a-tetrahydro-1H-2-benzofuran-5-one.
| Compound Name | (3R,3aS,4R,7aR)-3-hydroxy-3a,4-dimethyl-4-(3-oxobutyl)-3,6,7,7a-tetrahydro-1H-2-benzofuran-5-one |
|---|---|
| PubChem CID | 11391161 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (3R,3aS,4R,7aR)-3-hydroxy-3a,4-dimethyl-4-(3-oxobutyl)-3,6,7,7a-tetrahydro-1H-2-benzofuran-5-one |
| SMILES | CC(=O)CC[C@@]1(C)C(=O)CC[C@H]2CO[C@@H](O)[C@@]21C |
| InChI | InChI=1S/C14H22O4/c1-9(15)6-7-13(2)11(16)5-4-10-8-18-12(17)14(10,13)3/h10,12,17H,4-8H2,1-3H3/t10-,12+,13-,14+/m0/s1 |
| InChIKey | GGTBGKIBEFMBHJ-AHLTXXRQSA-N |
| XLogP | 1.70 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |