C15H18O4 — CID 11391360
(1R,2S,6R,7S)-10-acetyl-9,9-dimethoxytricyclo[5.2.2.02,6]undeca-4,10-dien-8-one (PubChem CID 11391360) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is (1R,2S,6R,7S)-10-acetyl-9,9-dimethoxytricyclo[5.2.2.02,6]undeca-4,10-dien-8-one.
| Compound Name | (1R,2S,6R,7S)-10-acetyl-9,9-dimethoxytricyclo[5.2.2.02,6]undeca-4,10-dien-8-one |
|---|---|
| PubChem CID | 11391360 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (1R,2S,6R,7S)-10-acetyl-9,9-dimethoxytricyclo[5.2.2.02,6]undeca-4,10-dien-8-one |
| SMILES | COC1(OC)C(=O)[C@@H]2C=C(C(C)=O)[C@H]1[C@H]1CC=C[C@H]12 |
| InChI | InChI=1S/C15H18O4/c1-8(16)11-7-12-9-5-4-6-10(9)13(11)15(18-2,19-3)14(12)17/h4-5,7,9-10,12-13H,6H2,1-3H3/t9-,10+,12-,13-/m1/s1 |
| InChIKey | NWPLAWIZYSSOQB-LYIQGSDWSA-N |
| XLogP | 1.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|