C15H25N3O — CID 11391402
(NE)-N-[[(7S)-7-(dipropylamino)-5,6,7,8-tetrahydroindolizin-3-yl]methylidene]hydroxylamine (PubChem CID 11391402) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is (NE)-N-[[(7S)-7-(dipropylamino)-5,6,7,8-tetrahydroindolizin-3-yl]methylidene]hydroxylamine.
| Compound Name | (NE)-N-[[(7S)-7-(dipropylamino)-5,6,7,8-tetrahydroindolizin-3-yl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 11391402 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | (NE)-N-[[(7S)-7-(dipropylamino)-5,6,7,8-tetrahydroindolizin-3-yl]methylidene]hydroxylamine |
| SMILES | CCCN(CCC)[C@H]1CCn2c(/C=N/O)ccc2C1 |
| InChI | InChI=1S/C15H25N3O/c1-3-8-17(9-4-2)13-7-10-18-14(11-13)5-6-15(18)12-16-19/h5-6,12-13,19H,3-4,7-11H2,1-2H3/b16-12+/t13-/m0/s1 |
| InChIKey | PJDIIZOQXMDDPU-HKJJFUAXSA-N |
| XLogP | 2.73 |
| TPSA | 40.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|