C16H26O3 — CID 11391479
[(2R,3S,6R,8R,9S)-8-but-2-ynyl-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methanol (PubChem CID 11391479) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is [(2R,3S,6R,8R,9S)-8-but-2-ynyl-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methanol.
| Compound Name | [(2R,3S,6R,8R,9S)-8-but-2-ynyl-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methanol |
|---|---|
| PubChem CID | 11391479 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | [(2R,3S,6R,8R,9S)-8-but-2-ynyl-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methanol |
| SMILES | CC#CC[C@H]1O[C@]2(CC[C@H](C)[C@H](CO)O2)CC[C@@H]1C |
| InChI | InChI=1S/C16H26O3/c1-4-5-6-14-12(2)7-9-16(18-14)10-8-13(3)15(11-17)19-16/h12-15,17H,6-11H2,1-3H3/t12-,13-,14+,15-,16+/m0/s1 |
| InChIKey | DAGSZXLCQWAVCB-ARKGTOAJSA-N |
| XLogP | 2.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|