C18H23NSi — CID 11391887
trimethyl-(3-phenyl-5,6,7,8-tetrahydroisoquinolin-4-yl)silane (PubChem CID 11391887) has the molecular formula C18H23NSi and a molecular weight of 281.47 g/mol. Its IUPAC name is trimethyl-(3-phenyl-5,6,7,8-tetrahydroisoquinolin-4-yl)silane.
| Compound Name | trimethyl-(3-phenyl-5,6,7,8-tetrahydroisoquinolin-4-yl)silane |
|---|---|
| PubChem CID | 11391887 |
| Molecular Formula | C18H23NSi |
| Molecular Weight | 281.47 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | trimethyl-(3-phenyl-5,6,7,8-tetrahydroisoquinolin-4-yl)silane |
| SMILES | C[Si](C)(C)c1c(-c2ccccc2)ncc2c1CCCC2 |
| InChI | InChI=1S/C18H23NSi/c1-20(2,3)18-16-12-8-7-11-15(16)13-19-17(18)14-9-5-4-6-10-14/h4-6,9-10,13H,7-8,11-12H2,1-3H3 |
| InChIKey | ICWYEJSOUJDDQL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|