C14H10N2O5 — CID 11392020
ethyl 1,2,4-trioxo-5H-pyrrolo[1,2-a]quinoxaline-3-carboxylate (PubChem CID 11392020) has the molecular formula C14H10N2O5 and a molecular weight of 286.24 g/mol. Its IUPAC name is ethyl 1,2,4-trioxo-5H-pyrrolo[1,2-a]quinoxaline-3-carboxylate.
| Compound Name | ethyl 1,2,4-trioxo-5H-pyrrolo[1,2-a]quinoxaline-3-carboxylate |
|---|---|
| PubChem CID | 11392020 |
| Molecular Formula | C14H10N2O5 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | ethyl 1,2,4-trioxo-5H-pyrrolo[1,2-a]quinoxaline-3-carboxylate |
| SMILES | CCOC(=O)C1=C2C(=O)Nc3ccccc3N2C(=O)C1=O |
| InChI | InChI=1S/C14H10N2O5/c1-2-21-14(20)9-10-12(18)15-7-5-3-4-6-8(7)16(10)13(19)11(9)17/h3-6H,2H2,1H3,(H,15,18) |
| InChIKey | PQXUGNBBLATRMP-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_fives(89)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|