About 2-[(4-pyridin-2-yl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1H-benzimidazole
2-[(4-pyridin-2-yl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1H-benzimidazole (PubChem CID 11392147) has the molecular formula C18H18N4
and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-[(4-pyridin-2-yl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-[(4-pyridin-2-yl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1H-benzimidazole |
| PubChem CID | 11392147 |
| Molecular Formula | C18H18N4 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-[(4-pyridin-2-yl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1H-benzimidazole |
| SMILES | C1=C(c2ccccn2)CCN(Cc2nc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C18H18N4/c1-2-7-17-16(6-1)20-18(21-17)13-22-11-8-14(9-12-22)15-5-3-4-10-19-15/h1-8,10H,9,11-13H2,(H,20,21) |
| InChIKey | PSXITITZQSEYMQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(4-pyridin-2-yl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-pyridin-2-yl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1H-benzimidazole?
The IUPAC name of 2-[(4-pyridin-2-yl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1H-benzimidazole (CID 11392147) is 2-[(4-pyridin-2-yl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1H-benzimidazole.
What is the SMILES notation for 2-[(4-pyridin-2-yl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1H-benzimidazole?
The canonical SMILES for 2-[(4-pyridin-2-yl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1H-benzimidazole is C1=C(c2ccccn2)CCN(Cc2nc3ccccc3[nH]2)C1.
What is the InChIKey of 2-[(4-pyridin-2-yl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1H-benzimidazole?
The InChIKey is PSXITITZQSEYMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4/c1-2-7-17-16(6-1)20-18(21-17)13-22-11-8-14(9-12-22)15-5-3-4-10-19-15/h1-8,10H,9,11-13H2,(H,20,21).
What are the key properties of 2-[(4-pyridin-2-yl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1H-benzimidazole?
2-[(4-pyridin-2-yl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1H-benzimidazole has a molecular weight of 290.37 g/mol, XLogP of 3.25, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-pyridin-2-yl-3,6-dihydro-2H-pyridin-1-yl)methyl]-1H-benzimidazole is sourced from PubChem (CID 11392147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).