About benzene;copper(1+);trifluoromethanesulfonate
benzene;copper(1+);trifluoromethanesulfonate (PubChem CID 11392160) has the molecular formula C7H6CuF3O3S
and a molecular weight of 290.73 g/mol. Its IUPAC name is benzene;copper(1+);trifluoromethanesulfonate.
Molecular Properties
| Compound Name | benzene;copper(1+);trifluoromethanesulfonate |
| PubChem CID | 11392160 |
| Molecular Formula | C7H6CuF3O3S |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 289.93 |
| IUPAC Name | benzene;copper(1+);trifluoromethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)F.[Cu+].c1ccccc1 |
| InChI | InChI=1S/C6H6.CHF3O3S.Cu/c1-2-4-6-5-3-1;2-1(3,4)8(5,6)7;/h1-6H;(H,5,6,7);/q;;+1/p-1 |
| InChIKey | BYBIRLURVZSVME-UHFFFAOYSA-M |
| XLogP | 1.74 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze benzene;copper(1+);trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;copper(1+);trifluoromethanesulfonate?
The IUPAC name of benzene;copper(1+);trifluoromethanesulfonate (CID 11392160) is benzene;copper(1+);trifluoromethanesulfonate.
What is the SMILES notation for benzene;copper(1+);trifluoromethanesulfonate?
The canonical SMILES for benzene;copper(1+);trifluoromethanesulfonate is O=S(=O)([O-])C(F)(F)F.[Cu+].c1ccccc1.
What is the InChIKey of benzene;copper(1+);trifluoromethanesulfonate?
The InChIKey is BYBIRLURVZSVME-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6.CHF3O3S.Cu/c1-2-4-6-5-3-1;2-1(3,4)8(5,6)7;/h1-6H;(H,5,6,7);/q;;+1/p-1.
What are the key properties of benzene;copper(1+);trifluoromethanesulfonate?
benzene;copper(1+);trifluoromethanesulfonate has a molecular weight of 290.73 g/mol, XLogP of 1.74, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;copper(1+);trifluoromethanesulfonate is sourced from PubChem (CID 11392160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).