C9H11IO3 — CID 11392234
(3aR,7aS)-6-iodo-2,2-dimethyl-4,7a-dihydro-3aH-1,3-benzodioxol-5-one (PubChem CID 11392234) has the molecular formula C9H11IO3 and a molecular weight of 294.09 g/mol. Its IUPAC name is (3aR,7aS)-6-iodo-2,2-dimethyl-4,7a-dihydro-3aH-1,3-benzodioxol-5-one.
| Compound Name | (3aR,7aS)-6-iodo-2,2-dimethyl-4,7a-dihydro-3aH-1,3-benzodioxol-5-one |
|---|---|
| PubChem CID | 11392234 |
| Molecular Formula | C9H11IO3 |
| Molecular Weight | 294.09 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | (3aR,7aS)-6-iodo-2,2-dimethyl-4,7a-dihydro-3aH-1,3-benzodioxol-5-one |
| SMILES | CC1(C)O[C@H]2C=C(I)C(=O)C[C@H]2O1 |
| InChI | InChI=1S/C9H11IO3/c1-9(2)12-7-3-5(10)6(11)4-8(7)13-9/h3,7-8H,4H2,1-2H3/t7-,8+/m0/s1 |
| InChIKey | QJUKGESAMATFAZ-JGVFFNPUSA-N |
| XLogP | 1.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.09 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|