C16H26O3Si — CID 11392269
(1R,5R,7S)-9-[tert-butyl(dimethyl)silyl]oxy-11-oxatricyclo[5.3.1.01,5]undec-9-en-8-one (PubChem CID 11392269) has the molecular formula C16H26O3Si and a molecular weight of 294.47 g/mol. Its IUPAC name is (1R,5R,7S)-9-[tert-butyl(dimethyl)silyl]oxy-11-oxatricyclo[5.3.1.01,5]undec-9-en-8-one.
| Compound Name | (1R,5R,7S)-9-[tert-butyl(dimethyl)silyl]oxy-11-oxatricyclo[5.3.1.01,5]undec-9-en-8-one |
|---|---|
| PubChem CID | 11392269 |
| Molecular Formula | C16H26O3Si |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (1R,5R,7S)-9-[tert-butyl(dimethyl)silyl]oxy-11-oxatricyclo[5.3.1.01,5]undec-9-en-8-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1=C[C@@]23CCC[C@@H]2C[C@H](O3)C1=O |
| InChI | InChI=1S/C16H26O3Si/c1-15(2,3)20(4,5)19-13-10-16-8-6-7-11(16)9-12(18-16)14(13)17/h10-12H,6-9H2,1-5H3/t11-,12+,16+/m1/s1 |
| InChIKey | NQIPSRNLHJZSBJ-WQGACYEGSA-N |
| XLogP | 3.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|