C14H22O5S — CID 11392478
[(1S,3S,4S,6R)-4-hydroxy-11-oxatricyclo[4.4.1.01,6]undec-8-en-3-yl] 2-methylpropane-2-sulfonate (PubChem CID 11392478) has the molecular formula C14H22O5S and a molecular weight of 302.39 g/mol. Its IUPAC name is [(1S,3S,4S,6R)-4-hydroxy-11-oxatricyclo[4.4.1.01,6]undec-8-en-3-yl] 2-methylpropane-2-sulfonate.
| Compound Name | [(1S,3S,4S,6R)-4-hydroxy-11-oxatricyclo[4.4.1.01,6]undec-8-en-3-yl] 2-methylpropane-2-sulfonate |
|---|---|
| PubChem CID | 11392478 |
| Molecular Formula | C14H22O5S |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | [(1S,3S,4S,6R)-4-hydroxy-11-oxatricyclo[4.4.1.01,6]undec-8-en-3-yl] 2-methylpropane-2-sulfonate |
| SMILES | CC(C)(C)S(=O)(=O)O[C@H]1C[C@@]23CC=CC[C@]2(C[C@@H]1O)O3 |
| InChI | InChI=1S/C14H22O5S/c1-12(2,3)20(16,17)18-11-9-14-7-5-4-6-13(14,19-14)8-10(11)15/h4-5,10-11,15H,6-9H2,1-3H3/t10-,11-,13+,14-/m0/s1 |
| InChIKey | WNBJOGDPLPIVPY-VTPLQMEGSA-N |
| XLogP | 1.51 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|