C17H25NO4 — CID 11392645
(E,5R,6S)-5-hydroxy-N-methoxy-N,6-dimethyl-7-phenylmethoxyhept-2-enamide (PubChem CID 11392645) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is (E,5R,6S)-5-hydroxy-N-methoxy-N,6-dimethyl-7-phenylmethoxyhept-2-enamide.
| Compound Name | (E,5R,6S)-5-hydroxy-N-methoxy-N,6-dimethyl-7-phenylmethoxyhept-2-enamide |
|---|---|
| PubChem CID | 11392645 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | (E,5R,6S)-5-hydroxy-N-methoxy-N,6-dimethyl-7-phenylmethoxyhept-2-enamide |
| SMILES | CON(C)C(=O)/C=C/C[C@@H](O)[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C17H25NO4/c1-14(12-22-13-15-8-5-4-6-9-15)16(19)10-7-11-17(20)18(2)21-3/h4-9,11,14,16,19H,10,12-13H2,1-3H3/b11-7+/t14-,16+/m0/s1 |
| InChIKey | HEEOUWMRRJFFIN-MWHIQHKOSA-N |
| XLogP | 2.17 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|