C18H16N2O3 — CID 11392711
(11Z)-13-deuterio-5,7-dimethyl-9-oxa-5,7-diazatetracyclo[12.4.1.02,10.03,8]nonadeca-1(18),2(10),3(8),11,14,16-hexaene-4,6-dione (PubChem CID 11392711) has the molecular formula C18H16N2O3 and a molecular weight of 309.34 g/mol. Its IUPAC name is (11Z)-13-deuterio-5,7-dimethyl-9-oxa-5,7-diazatetracyclo[12.4.1.02,10.03,8]nonadeca-1(18),2(10),3(8),11,14,16-hexaene-4,6-dione.
| Compound Name | (11Z)-13-deuterio-5,7-dimethyl-9-oxa-5,7-diazatetracyclo[12.4.1.02,10.03,8]nonadeca-1(18),2(10),3(8),11,14,16-hexaene-4,6-dione |
|---|---|
| PubChem CID | 11392711 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (11Z)-13-deuterio-5,7-dimethyl-9-oxa-5,7-diazatetracyclo[12.4.1.02,10.03,8]nonadeca-1(18),2(10),3(8),11,14,16-hexaene-4,6-dione |
| SMILES | [2H]C1/C=C\c2oc3c(c2C2=CC=CC=C1C2)c(=O)n(C)c(=O)n3C |
| InChI | InChI=1S/C18H16N2O3/c1-19-16(21)15-14-12-8-4-3-6-11(10-12)7-5-9-13(14)23-17(15)20(2)18(19)22/h3-6,8-9H,7,10H2,1-2H3/b9-5-/i7D |
| InChIKey | LLECLZSZCDHJGO-NSTSQMSWSA-N |
| XLogP | 2.52 |
| TPSA | 57.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |