About 2-(2-hydroxyethyl)-1,3-dioxan-4-ol
2-(2-hydroxyethyl)-1,3-dioxan-4-ol (PubChem CID 11392858) has the molecular formula C6H12O4
and a molecular weight of 148.16 g/mol. Its IUPAC name is 2-(2-hydroxyethyl)-1,3-dioxan-4-ol.
Molecular Properties
| Compound Name | 2-(2-hydroxyethyl)-1,3-dioxan-4-ol |
| PubChem CID | 11392858 |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 2-(2-hydroxyethyl)-1,3-dioxan-4-ol |
| SMILES | OCCC1OCCC(O)O1 |
| InChI | InChI=1S/C6H12O4/c7-3-1-6-9-4-2-5(8)10-6/h5-8H,1-4H2 |
| InChIKey | CMFSVRNUSJXFLF-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-hydroxyethyl)-1,3-dioxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethyl)-1,3-dioxan-4-ol?
The IUPAC name of 2-(2-hydroxyethyl)-1,3-dioxan-4-ol (CID 11392858) is 2-(2-hydroxyethyl)-1,3-dioxan-4-ol.
What is the SMILES notation for 2-(2-hydroxyethyl)-1,3-dioxan-4-ol?
The canonical SMILES for 2-(2-hydroxyethyl)-1,3-dioxan-4-ol is OCCC1OCCC(O)O1.
What is the InChIKey of 2-(2-hydroxyethyl)-1,3-dioxan-4-ol?
The InChIKey is CMFSVRNUSJXFLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O4/c7-3-1-6-9-4-2-5(8)10-6/h5-8H,1-4H2.
What are the key properties of 2-(2-hydroxyethyl)-1,3-dioxan-4-ol?
2-(2-hydroxyethyl)-1,3-dioxan-4-ol has a molecular weight of 148.16 g/mol, XLogP of -0.55, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethyl)-1,3-dioxan-4-ol is sourced from PubChem (CID 11392858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).