About 2-amino-4-(4-fluorophenyl)-6-(2-hydroxyethylsulfanyl)pyridine-3,5-dicarbonitrile
2-amino-4-(4-fluorophenyl)-6-(2-hydroxyethylsulfanyl)pyridine-3,5-dicarbonitrile (PubChem CID 11392863) has the molecular formula C15H11FN4OS
and a molecular weight of 314.35 g/mol. Its IUPAC name is 2-amino-4-(4-fluorophenyl)-6-(2-hydroxyethylsulfanyl)pyridine-3,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2-amino-4-(4-fluorophenyl)-6-(2-hydroxyethylsulfanyl)pyridine-3,5-dicarbonitrile |
| PubChem CID | 11392863 |
| Molecular Formula | C15H11FN4OS |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 2-amino-4-(4-fluorophenyl)-6-(2-hydroxyethylsulfanyl)pyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(N)nc(SCCO)c(C#N)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C15H11FN4OS/c16-10-3-1-9(2-4-10)13-11(7-17)14(19)20-15(12(13)8-18)22-6-5-21/h1-4,21H,5-6H2,(H2,19,20) |
| InChIKey | WUPCRZWERJUCEX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 106.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-4-(4-fluorophenyl)-6-(2-hydroxyethylsulfanyl)pyridine-3,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(4-fluorophenyl)-6-(2-hydroxyethylsulfanyl)pyridine-3,5-dicarbonitrile?
The IUPAC name of 2-amino-4-(4-fluorophenyl)-6-(2-hydroxyethylsulfanyl)pyridine-3,5-dicarbonitrile (CID 11392863) is 2-amino-4-(4-fluorophenyl)-6-(2-hydroxyethylsulfanyl)pyridine-3,5-dicarbonitrile.
What is the SMILES notation for 2-amino-4-(4-fluorophenyl)-6-(2-hydroxyethylsulfanyl)pyridine-3,5-dicarbonitrile?
The canonical SMILES for 2-amino-4-(4-fluorophenyl)-6-(2-hydroxyethylsulfanyl)pyridine-3,5-dicarbonitrile is N#Cc1c(N)nc(SCCO)c(C#N)c1-c1ccc(F)cc1.
What is the InChIKey of 2-amino-4-(4-fluorophenyl)-6-(2-hydroxyethylsulfanyl)pyridine-3,5-dicarbonitrile?
The InChIKey is WUPCRZWERJUCEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11FN4OS/c16-10-3-1-9(2-4-10)13-11(7-17)14(19)20-15(12(13)8-18)22-6-5-21/h1-4,21H,5-6H2,(H2,19,20).
What are the key properties of 2-amino-4-(4-fluorophenyl)-6-(2-hydroxyethylsulfanyl)pyridine-3,5-dicarbonitrile?
2-amino-4-(4-fluorophenyl)-6-(2-hydroxyethylsulfanyl)pyridine-3,5-dicarbonitrile has a molecular weight of 314.35 g/mol, XLogP of 2.30, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(4-fluorophenyl)-6-(2-hydroxyethylsulfanyl)pyridine-3,5-dicarbonitrile is sourced from PubChem (CID 11392863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).