About 2-naphthalen-2-ylacetic acid
2-naphthalen-2-ylacetic acid (PubChem CID 11393) has the molecular formula C12H10O2
and a molecular weight of 186.21 g/mol. Its IUPAC name is 2-naphthalen-2-ylacetic acid.
Molecular Properties
| Compound Name | 2-naphthalen-2-ylacetic acid |
| PubChem CID | 11393 |
| Molecular Formula | C12H10O2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 2-naphthalen-2-ylacetic acid |
| SMILES | O=C(O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H10O2/c13-12(14)8-9-5-6-10-3-1-2-4-11(10)7-9/h1-7H,8H2,(H,13,14) |
| InChIKey | VIBOGIYPPWLDTI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-naphthalen-2-ylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-naphthalen-2-ylacetic acid?
The IUPAC name of 2-naphthalen-2-ylacetic acid (CID 11393) is 2-naphthalen-2-ylacetic acid.
What is the SMILES notation for 2-naphthalen-2-ylacetic acid?
The canonical SMILES for 2-naphthalen-2-ylacetic acid is O=C(O)Cc1ccc2ccccc2c1.
What is the InChIKey of 2-naphthalen-2-ylacetic acid?
The InChIKey is VIBOGIYPPWLDTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2/c13-12(14)8-9-5-6-10-3-1-2-4-11(10)7-9/h1-7H,8H2,(H,13,14).
What are the key properties of 2-naphthalen-2-ylacetic acid?
2-naphthalen-2-ylacetic acid has a molecular weight of 186.21 g/mol, XLogP of 2.47, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-naphthalen-2-ylacetic acid is sourced from PubChem (CID 11393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).