About N-cyclopentyl-2-(2,3-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine
N-cyclopentyl-2-(2,3-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine (PubChem CID 1139308) has the molecular formula C21H25N3O2
and a molecular weight of 351.45 g/mol. Its IUPAC name is N-cyclopentyl-2-(2,3-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine.
Molecular Properties
| Compound Name | N-cyclopentyl-2-(2,3-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine |
| PubChem CID | 1139308 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | N-cyclopentyl-2-(2,3-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine |
| SMILES | COc1cccc(-c2nc3cc(C)ccn3c2NC2CCCC2)c1OC |
| InChI | InChI=1S/C21H25N3O2/c1-14-11-12-24-18(13-14)23-19(21(24)22-15-7-4-5-8-15)16-9-6-10-17(25-2)20(16)26-3/h6,9-13,15,22H,4-5,7-8H2,1-3H3 |
| InChIKey | QQGBKQAYTSLZCK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 47.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-cyclopentyl-2-(2,3-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-2-(2,3-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine?
The IUPAC name of N-cyclopentyl-2-(2,3-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine (CID 1139308) is N-cyclopentyl-2-(2,3-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine.
What is the SMILES notation for N-cyclopentyl-2-(2,3-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine?
The canonical SMILES for N-cyclopentyl-2-(2,3-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine is COc1cccc(-c2nc3cc(C)ccn3c2NC2CCCC2)c1OC.
What is the InChIKey of N-cyclopentyl-2-(2,3-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine?
The InChIKey is QQGBKQAYTSLZCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N3O2/c1-14-11-12-24-18(13-14)23-19(21(24)22-15-7-4-5-8-15)16-9-6-10-17(25-2)20(16)26-3/h6,9-13,15,22H,4-5,7-8H2,1-3H3.
What are the key properties of N-cyclopentyl-2-(2,3-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine?
N-cyclopentyl-2-(2,3-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine has a molecular weight of 351.45 g/mol, XLogP of 4.68, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-2-(2,3-dimethoxyphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine is sourced from PubChem (CID 1139308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).