C16H20ClFN2O2 — CID 11393255
tert-butyl (1R,2R,4R,5S)-2-(6-chloro-3-pyridinyl)-5-fluoro-7-azabicyclo[2.2.1]heptane-7-carboxylate (PubChem CID 11393255) has the molecular formula C16H20ClFN2O2 and a molecular weight of 326.80 g/mol. Its IUPAC name is tert-butyl (1R,2R,4R,5S)-2-(6-chloro-3-pyridinyl)-5-fluoro-7-azabicyclo[2.2.1]heptane-7-carboxylate.
| Compound Name | tert-butyl (1R,2R,4R,5S)-2-(6-chloro-3-pyridinyl)-5-fluoro-7-azabicyclo[2.2.1]heptane-7-carboxylate |
|---|---|
| PubChem CID | 11393255 |
| Molecular Formula | C16H20ClFN2O2 |
| Molecular Weight | 326.80 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | tert-butyl (1R,2R,4R,5S)-2-(6-chloro-3-pyridinyl)-5-fluoro-7-azabicyclo[2.2.1]heptane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2C[C@H](F)[C@H]1C[C@@H]2c1ccc(Cl)nc1 |
| InChI | InChI=1S/C16H20ClFN2O2/c1-16(2,3)22-15(21)20-12-7-11(18)13(20)6-10(12)9-4-5-14(17)19-8-9/h4-5,8,10-13H,6-7H2,1-3H3/t10-,11+,12-,13-/m1/s1 |
| InChIKey | ZMDNLBDQLWZGMB-YVECIDJPSA-N |
| XLogP | 3.94 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.80 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|