C17H32O4Si — CID 11393316
1-[tert-butyl(dimethyl)silyl]oxy-2-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-2-ol (PubChem CID 11393316) has the molecular formula C17H32O4Si and a molecular weight of 328.53 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxy-2-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-2-ol.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxy-2-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-2-ol |
|---|---|
| PubChem CID | 11393316 |
| Molecular Formula | C17H32O4Si |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxy-2-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]but-3-en-2-ol |
| SMILES | C=C[C@@H]1OC(C)(C)O[C@@H]1C(O)(C=C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O4Si/c1-10-13-14(21-16(6,7)20-13)17(18,11-2)12-19-22(8,9)15(3,4)5/h10-11,13-14,18H,1-2,12H2,3-9H3/t13-,14-,17?/m0/s1 |
| InChIKey | ARFOYXXGEWPWLE-CBVZESEGSA-N |
| XLogP | 3.63 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|