About N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide
N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide (PubChem CID 1139334) has the molecular formula C17H14N2OS
and a molecular weight of 294.38 g/mol. Its IUPAC name is N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
| PubChem CID | 1139334 |
| Molecular Formula | C17H14N2OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide |
| SMILES | CN(C(=O)c1ccccc1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C17H14N2OS/c1-19(16(20)14-10-6-3-7-11-14)17-18-15(12-21-17)13-8-4-2-5-9-13/h2-12H,1H3 |
| InChIKey | LHPKVYFPIMGYFA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide?
The IUPAC name of N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide (CID 1139334) is N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide?
The canonical SMILES for N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide is CN(C(=O)c1ccccc1)c1nc(-c2ccccc2)cs1.
What is the InChIKey of N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide?
The InChIKey is LHPKVYFPIMGYFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2OS/c1-19(16(20)14-10-6-3-7-11-14)17-18-15(12-21-17)13-8-4-2-5-9-13/h2-12H,1H3.
What are the key properties of N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide?
N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide has a molecular weight of 294.38 g/mol, XLogP of 4.09, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 1139334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).