C23H26N2 — CID 11393372
2-hex-1-ynyl-4,5-dimethyl-6-(5-phenylpent-1-ynyl)pyrimidine (PubChem CID 11393372) has the molecular formula C23H26N2 and a molecular weight of 330.48 g/mol. Its IUPAC name is 2-hex-1-ynyl-4,5-dimethyl-6-(5-phenylpent-1-ynyl)pyrimidine.
| Compound Name | 2-hex-1-ynyl-4,5-dimethyl-6-(5-phenylpent-1-ynyl)pyrimidine |
|---|---|
| PubChem CID | 11393372 |
| Molecular Formula | C23H26N2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 2-hex-1-ynyl-4,5-dimethyl-6-(5-phenylpent-1-ynyl)pyrimidine |
| SMILES | CCCCC#Cc1nc(C)c(C)c(C#CCCCc2ccccc2)n1 |
| InChI | InChI=1S/C23H26N2/c1-4-5-6-13-18-23-24-20(3)19(2)22(25-23)17-12-8-11-16-21-14-9-7-10-15-21/h7,9-10,14-15H,4-6,8,11,16H2,1-3H3 |
| InChIKey | SXMJRFCULRVIRX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|