About 6-iodo-2,2-dimethyl-5-nitrochromene
6-iodo-2,2-dimethyl-5-nitrochromene (PubChem CID 11393379) has the molecular formula C11H10INO3
and a molecular weight of 331.11 g/mol. Its IUPAC name is 6-iodo-2,2-dimethyl-5-nitrochromene.
Molecular Properties
| Compound Name | 6-iodo-2,2-dimethyl-5-nitrochromene |
| PubChem CID | 11393379 |
| Molecular Formula | C11H10INO3 |
| Molecular Weight | 331.11 g/mol |
| Exact Mass | 330.97 |
| IUPAC Name | 6-iodo-2,2-dimethyl-5-nitrochromene |
| SMILES | CC1(C)C=Cc2c(ccc(I)c2[N+](=O)[O-])O1 |
| InChI | InChI=1S/C11H10INO3/c1-11(2)6-5-7-9(16-11)4-3-8(12)10(7)13(14)15/h3-6H,1-2H3 |
| InChIKey | BUIMTKJLGZOIJB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.11 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-2,2-dimethyl-5-nitrochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-2,2-dimethyl-5-nitrochromene?
The IUPAC name of 6-iodo-2,2-dimethyl-5-nitrochromene (CID 11393379) is 6-iodo-2,2-dimethyl-5-nitrochromene.
What is the SMILES notation for 6-iodo-2,2-dimethyl-5-nitrochromene?
The canonical SMILES for 6-iodo-2,2-dimethyl-5-nitrochromene is CC1(C)C=Cc2c(ccc(I)c2[N+](=O)[O-])O1.
What is the InChIKey of 6-iodo-2,2-dimethyl-5-nitrochromene?
The InChIKey is BUIMTKJLGZOIJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10INO3/c1-11(2)6-5-7-9(16-11)4-3-8(12)10(7)13(14)15/h3-6H,1-2H3.
What are the key properties of 6-iodo-2,2-dimethyl-5-nitrochromene?
6-iodo-2,2-dimethyl-5-nitrochromene has a molecular weight of 331.11 g/mol, XLogP of 3.38, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-2,2-dimethyl-5-nitrochromene is sourced from PubChem (CID 11393379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).