About 2-chloro-5-(5,6-dichloro-1H-indol-2-yl)benzoic acid
2-chloro-5-(5,6-dichloro-1H-indol-2-yl)benzoic acid (PubChem CID 11393662) has the molecular formula C15H8Cl3NO2
and a molecular weight of 340.59 g/mol. Its IUPAC name is 2-chloro-5-(5,6-dichloro-1H-indol-2-yl)benzoic acid.
Molecular Properties
| Compound Name | 2-chloro-5-(5,6-dichloro-1H-indol-2-yl)benzoic acid |
| PubChem CID | 11393662 |
| Molecular Formula | C15H8Cl3NO2 |
| Molecular Weight | 340.59 g/mol |
| Exact Mass | 338.96 |
| IUPAC Name | 2-chloro-5-(5,6-dichloro-1H-indol-2-yl)benzoic acid |
| SMILES | O=C(O)c1cc(-c2cc3cc(Cl)c(Cl)cc3[nH]2)ccc1Cl |
| InChI | InChI=1S/C15H8Cl3NO2/c16-10-2-1-7(3-9(10)15(20)21)13-5-8-4-11(17)12(18)6-14(8)19-13/h1-6,19H,(H,20,21) |
| InChIKey | GOTDXXMFYCGSES-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.59 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-chloro-5-(5,6-dichloro-1H-indol-2-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-(5,6-dichloro-1H-indol-2-yl)benzoic acid?
The IUPAC name of 2-chloro-5-(5,6-dichloro-1H-indol-2-yl)benzoic acid (CID 11393662) is 2-chloro-5-(5,6-dichloro-1H-indol-2-yl)benzoic acid.
What is the SMILES notation for 2-chloro-5-(5,6-dichloro-1H-indol-2-yl)benzoic acid?
The canonical SMILES for 2-chloro-5-(5,6-dichloro-1H-indol-2-yl)benzoic acid is O=C(O)c1cc(-c2cc3cc(Cl)c(Cl)cc3[nH]2)ccc1Cl.
What is the InChIKey of 2-chloro-5-(5,6-dichloro-1H-indol-2-yl)benzoic acid?
The InChIKey is GOTDXXMFYCGSES-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8Cl3NO2/c16-10-2-1-7(3-9(10)15(20)21)13-5-8-4-11(17)12(18)6-14(8)19-13/h1-6,19H,(H,20,21).
What are the key properties of 2-chloro-5-(5,6-dichloro-1H-indol-2-yl)benzoic acid?
2-chloro-5-(5,6-dichloro-1H-indol-2-yl)benzoic acid has a molecular weight of 340.59 g/mol, XLogP of 5.49, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-(5,6-dichloro-1H-indol-2-yl)benzoic acid is sourced from PubChem (CID 11393662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).