C18H34O4Si — CID 11393734
[(4aR,6S,7R,8aS)-2,2-dimethyl-6-prop-2-enyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11393734) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is [(4aR,6S,7R,8aS)-2,2-dimethyl-6-prop-2-enyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(4aR,6S,7R,8aS)-2,2-dimethyl-6-prop-2-enyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11393734 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | [(4aR,6S,7R,8aS)-2,2-dimethyl-6-prop-2-enyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=CC[C@@H]1O[C@@H]2COC(C)(C)O[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34O4Si/c1-9-10-13-15(22-23(7,8)17(2,3)4)11-14-16(20-13)12-19-18(5,6)21-14/h9,13-16H,1,10-12H2,2-8H3/t13-,14-,15+,16+/m0/s1 |
| InChIKey | JPBODJVHNSRXDQ-CAOSSQGBSA-N |
| XLogP | 4.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|