About N-benzyl-N-(4-phenyl-1,3-thiazol-2-yl)acetamide
N-benzyl-N-(4-phenyl-1,3-thiazol-2-yl)acetamide (PubChem CID 1139387) has the molecular formula C18H16N2OS
and a molecular weight of 308.41 g/mol. Its IUPAC name is N-benzyl-N-(4-phenyl-1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | N-benzyl-N-(4-phenyl-1,3-thiazol-2-yl)acetamide |
| PubChem CID | 1139387 |
| Molecular Formula | C18H16N2OS |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | N-benzyl-N-(4-phenyl-1,3-thiazol-2-yl)acetamide |
| SMILES | CC(=O)N(Cc1ccccc1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H16N2OS/c1-14(21)20(12-15-8-4-2-5-9-15)18-19-17(13-22-18)16-10-6-3-7-11-16/h2-11,13H,12H2,1H3 |
| InChIKey | BFNYOOCMFPHLMR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-N-(4-phenyl-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-(4-phenyl-1,3-thiazol-2-yl)acetamide?
The IUPAC name of N-benzyl-N-(4-phenyl-1,3-thiazol-2-yl)acetamide (CID 1139387) is N-benzyl-N-(4-phenyl-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for N-benzyl-N-(4-phenyl-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for N-benzyl-N-(4-phenyl-1,3-thiazol-2-yl)acetamide is CC(=O)N(Cc1ccccc1)c1nc(-c2ccccc2)cs1.
What is the InChIKey of N-benzyl-N-(4-phenyl-1,3-thiazol-2-yl)acetamide?
The InChIKey is BFNYOOCMFPHLMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2OS/c1-14(21)20(12-15-8-4-2-5-9-15)18-19-17(13-22-18)16-10-6-3-7-11-16/h2-11,13H,12H2,1H3.
What are the key properties of N-benzyl-N-(4-phenyl-1,3-thiazol-2-yl)acetamide?
N-benzyl-N-(4-phenyl-1,3-thiazol-2-yl)acetamide has a molecular weight of 308.41 g/mol, XLogP of 4.36, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-(4-phenyl-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 1139387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).