C18H25NO2SSi — CID 11393898
trimethyl-[1-(4-methylphenyl)sulfonyl-2,3,3a,6-tetrahydroindol-7-yl]silane (PubChem CID 11393898) has the molecular formula C18H25NO2SSi and a molecular weight of 347.56 g/mol. Its IUPAC name is trimethyl-[1-(4-methylphenyl)sulfonyl-2,3,3a,6-tetrahydroindol-7-yl]silane.
| Compound Name | trimethyl-[1-(4-methylphenyl)sulfonyl-2,3,3a,6-tetrahydroindol-7-yl]silane |
|---|---|
| PubChem CID | 11393898 |
| Molecular Formula | C18H25NO2SSi |
| Molecular Weight | 347.56 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | trimethyl-[1-(4-methylphenyl)sulfonyl-2,3,3a,6-tetrahydroindol-7-yl]silane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC3C=CCC([Si](C)(C)C)=C32)cc1 |
| InChI | InChI=1S/C18H25NO2SSi/c1-14-8-10-16(11-9-14)22(20,21)19-13-12-15-6-5-7-17(18(15)19)23(2,3)4/h5-6,8-11,15H,7,12-13H2,1-4H3 |
| InChIKey | AHFMKHFTNVZIBH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|