About N-benzyl-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide
N-benzyl-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide (PubChem CID 1139390) has the molecular formula C24H20N2O2S
and a molecular weight of 400.50 g/mol. Its IUPAC name is N-benzyl-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | N-benzyl-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide |
| PubChem CID | 1139390 |
| Molecular Formula | C24H20N2O2S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-benzyl-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(COc1ccccc1)N(Cc1ccccc1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C24H20N2O2S/c27-23(17-28-21-14-8-3-9-15-21)26(16-19-10-4-1-5-11-19)24-25-22(18-29-24)20-12-6-2-7-13-20/h1-15,18H,16-17H2 |
| InChIKey | MAVVBZPOQOLLAW-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-benzyl-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide?
The IUPAC name of N-benzyl-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide (CID 1139390) is N-benzyl-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for N-benzyl-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for N-benzyl-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide is O=C(COc1ccccc1)N(Cc1ccccc1)c1nc(-c2ccccc2)cs1.
What is the InChIKey of N-benzyl-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide?
The InChIKey is MAVVBZPOQOLLAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N2O2S/c27-23(17-28-21-14-8-3-9-15-21)26(16-19-10-4-1-5-11-19)24-25-22(18-29-24)20-12-6-2-7-13-20/h1-15,18H,16-17H2.
What are the key properties of N-benzyl-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide?
N-benzyl-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide has a molecular weight of 400.50 g/mol, XLogP of 5.42, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-phenoxy-N-(4-phenyl-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 1139390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).