C18H24O5S — CID 11394036
(3S,4R,5R)-3-(benzenesulfonyl)-4-(2-hydroxyethyl)-3-prop-2-enyl-5-propyloxolan-2-one (PubChem CID 11394036) has the molecular formula C18H24O5S and a molecular weight of 352.45 g/mol. Its IUPAC name is (3S,4R,5R)-3-(benzenesulfonyl)-4-(2-hydroxyethyl)-3-prop-2-enyl-5-propyloxolan-2-one.
| Compound Name | (3S,4R,5R)-3-(benzenesulfonyl)-4-(2-hydroxyethyl)-3-prop-2-enyl-5-propyloxolan-2-one |
|---|---|
| PubChem CID | 11394036 |
| Molecular Formula | C18H24O5S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (3S,4R,5R)-3-(benzenesulfonyl)-4-(2-hydroxyethyl)-3-prop-2-enyl-5-propyloxolan-2-one |
| SMILES | C=CC[C@@]1(S(=O)(=O)c2ccccc2)C(=O)O[C@H](CCC)[C@H]1CCO |
| InChI | InChI=1S/C18H24O5S/c1-3-8-16-15(11-13-19)18(12-4-2,17(20)23-16)24(21,22)14-9-6-5-7-10-14/h4-7,9-10,15-16,19H,2-3,8,11-13H2,1H3/t15-,16-,18+/m1/s1 |
| InChIKey | FATQDDMSYIPSEM-NUJGCVRESA-N |
| XLogP | 2.50 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|