C21H22OS2 — CID 11394110
(2Z,4E)-3-methylsulfanyl-4-phenylsulfanyl-5-(2,4,6-trimethylphenyl)penta-2,4-dienal (PubChem CID 11394110) has the molecular formula C21H22OS2 and a molecular weight of 354.54 g/mol. Its IUPAC name is (2Z,4E)-3-methylsulfanyl-4-phenylsulfanyl-5-(2,4,6-trimethylphenyl)penta-2,4-dienal.
| Compound Name | (2Z,4E)-3-methylsulfanyl-4-phenylsulfanyl-5-(2,4,6-trimethylphenyl)penta-2,4-dienal |
|---|---|
| PubChem CID | 11394110 |
| Molecular Formula | C21H22OS2 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | (2Z,4E)-3-methylsulfanyl-4-phenylsulfanyl-5-(2,4,6-trimethylphenyl)penta-2,4-dienal |
| SMILES | CSC(=C\C=O)/C(=C\c1c(C)cc(C)cc1C)Sc1ccccc1 |
| InChI | InChI=1S/C21H22OS2/c1-15-12-16(2)19(17(3)13-15)14-21(20(23-4)10-11-22)24-18-8-6-5-7-9-18/h5-14H,1-4H3/b20-10-,21-14+ |
| InChIKey | PTKNEYRJDGVZCM-JOENVBCCSA-N |
| XLogP | 6.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|