C12H9F5O3S2 — CID 11394295
(2,3,4,5,6-pentafluorophenyl) 3-(3-sulfanylpropanoylsulfanyl)propanoate (PubChem CID 11394295) has the molecular formula C12H9F5O3S2 and a molecular weight of 360.33 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3-(3-sulfanylpropanoylsulfanyl)propanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3-(3-sulfanylpropanoylsulfanyl)propanoate |
|---|---|
| PubChem CID | 11394295 |
| Molecular Formula | C12H9F5O3S2 |
| Molecular Weight | 360.33 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-(3-sulfanylpropanoylsulfanyl)propanoate |
| SMILES | O=C(CCSC(=O)CCS)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H9F5O3S2/c13-7-8(14)10(16)12(11(17)9(7)15)20-5(18)2-4-22-6(19)1-3-21/h21H,1-4H2 |
| InChIKey | WZWIXTZNZKBWDT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|