C22H32O4 — CID 11394313
methyl 2,4-dimethyl-3,5-dioxo-5-[(1S,4S,5R,6S)-1,3,6-trimethyl-4-[(E)-pent-2-en-2-yl]-6-bicyclo[3.1.0]hex-2-enyl]pentanoate (PubChem CID 11394313) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is methyl 2,4-dimethyl-3,5-dioxo-5-[(1S,4S,5R,6S)-1,3,6-trimethyl-4-[(E)-pent-2-en-2-yl]-6-bicyclo[3.1.0]hex-2-enyl]pentanoate.
| Compound Name | methyl 2,4-dimethyl-3,5-dioxo-5-[(1S,4S,5R,6S)-1,3,6-trimethyl-4-[(E)-pent-2-en-2-yl]-6-bicyclo[3.1.0]hex-2-enyl]pentanoate |
|---|---|
| PubChem CID | 11394313 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | methyl 2,4-dimethyl-3,5-dioxo-5-[(1S,4S,5R,6S)-1,3,6-trimethyl-4-[(E)-pent-2-en-2-yl]-6-bicyclo[3.1.0]hex-2-enyl]pentanoate |
| SMILES | CC/C=C(\C)[C@H]1C(C)=C[C@@]2(C)[C@@H]1[C@]2(C)C(=O)C(C)C(=O)C(C)C(=O)OC |
| InChI | InChI=1S/C22H32O4/c1-9-10-12(2)16-13(3)11-21(6)18(16)22(21,7)19(24)14(4)17(23)15(5)20(25)26-8/h10-11,14-16,18H,9H2,1-8H3/b12-10+/t14?,15?,16-,18+,21-,22+/m0/s1 |
| InChIKey | HLYOPXLXNRPHEI-CPVTWSTKSA-N |
| XLogP | 4.14 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|