C21H12N4OS — CID 11394548
11-benzo[e][1]benzofuran-2-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine (PubChem CID 11394548) has the molecular formula C21H12N4OS and a molecular weight of 368.42 g/mol. Its IUPAC name is 11-benzo[e][1]benzofuran-2-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine.
| Compound Name | 11-benzo[e][1]benzofuran-2-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
|---|---|
| PubChem CID | 11394548 |
| Molecular Formula | C21H12N4OS |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 11-benzo[e][1]benzofuran-2-yl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-amine |
| SMILES | Nc1ncnc2c1sc1nc(-c3cc4c(ccc5ccccc54)o3)ccc12 |
| InChI | InChI=1S/C21H12N4OS/c22-20-19-18(23-10-24-20)13-6-7-15(25-21(13)27-19)17-9-14-12-4-2-1-3-11(12)5-8-16(14)26-17/h1-10H,(H2,22,23,24) |
| InChIKey | YCLFJVQEQWYHEP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |