C20H36N2O4 — CID 11394568
(3aR,4S,6aS)-5-butanoyl-2,2-dimethyl-N-(2,4,4-trimethylpentan-2-yl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide (PubChem CID 11394568) has the molecular formula C20H36N2O4 and a molecular weight of 368.52 g/mol. Its IUPAC name is (3aR,4S,6aS)-5-butanoyl-2,2-dimethyl-N-(2,4,4-trimethylpentan-2-yl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide.
| Compound Name | (3aR,4S,6aS)-5-butanoyl-2,2-dimethyl-N-(2,4,4-trimethylpentan-2-yl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 11394568 |
| Molecular Formula | C20H36N2O4 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | (3aR,4S,6aS)-5-butanoyl-2,2-dimethyl-N-(2,4,4-trimethylpentan-2-yl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxamide |
| SMILES | CCCC(=O)N1C[C@@H]2OC(C)(C)O[C@@H]2[C@H]1C(=O)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C20H36N2O4/c1-9-10-14(23)22-11-13-16(26-20(7,8)25-13)15(22)17(24)21-19(5,6)12-18(2,3)4/h13,15-16H,9-12H2,1-8H3,(H,21,24)/t13-,15-,16-/m0/s1 |
| InChIKey | RSBHWPPNUSCQIC-BPUTZDHNSA-N |
| XLogP | 2.85 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |