C24H27NO3 — CID 11394793
(3E,5E)-3,5-bis[(4-hydroxy-3,5-dimethylphenyl)methylidene]-1-methylpiperidin-4-one (PubChem CID 11394793) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[(4-hydroxy-3,5-dimethylphenyl)methylidene]-1-methylpiperidin-4-one.
| Compound Name | (3E,5E)-3,5-bis[(4-hydroxy-3,5-dimethylphenyl)methylidene]-1-methylpiperidin-4-one |
|---|---|
| PubChem CID | 11394793 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (3E,5E)-3,5-bis[(4-hydroxy-3,5-dimethylphenyl)methylidene]-1-methylpiperidin-4-one |
| SMILES | Cc1cc(/C=C2\CN(C)C/C(=C\c3cc(C)c(O)c(C)c3)C2=O)cc(C)c1O |
| InChI | InChI=1S/C24H27NO3/c1-14-6-18(7-15(2)22(14)26)10-20-12-25(5)13-21(24(20)28)11-19-8-16(3)23(27)17(4)9-19/h6-11,26-27H,12-13H2,1-5H3/b20-10+,21-11+ |
| InChIKey | KDTYVVMFLLNRKK-CLVAPQHMSA-N |
| XLogP | 4.31 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|